ChemNet > CAS > 98800-10-3 메틸 티에노[3,2-b]티오펜-2-카르복실레이트
98800-10-3 메틸 티에노[3,2-b]티오펜-2-카르복실레이트
| 상품명칭 |
메틸 티에노[3,2-b]티오펜-2-카르복실레이트 |
| 영문 이름 |
methyl thieno[3,2-b]thiophene-2-carboxylate; |
| 분자식 |
C8H6O2S2 |
| 분자량 |
198.262 |
| InChI |
InChI=1/C8H6O2S2/c1-10-8(9)7-4-6-5(12-7)2-3-11-6/h2-4H,1H3 |
| cas번호 |
98800-10-3 |
| 분자 구조 |
|
| 밀도 |
1.412g/cm3 |
| 녹는 점 |
94℃ |
| 비등점 |
306.1°C at 760 mmHg |
| 굴절 지수 |
1.673 |
| 인화점 |
138.9°C |
| 증기압 |
0.000788mmHg at 25°C |
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|